C12H7Cl3LiN3O4 — CID 158642535
lithium;2-amino-6-chloropyridine-3-carboxylate;2,6-dichloropyridine-3-carboxylic acid (PubChem CID 158642535) has the molecular formula C12H7Cl3LiN3O4 and a molecular weight of 370.51 g/mol. Its IUPAC name is lithium;2-amino-6-chloropyridine-3-carboxylate;2,6-dichloropyridine-3-carboxylic acid.
| Compound Name | lithium;2-amino-6-chloropyridine-3-carboxylate;2,6-dichloropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 158642535 |
| Molecular Formula | C12H7Cl3LiN3O4 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | lithium;2-amino-6-chloropyridine-3-carboxylate;2,6-dichloropyridine-3-carboxylic acid |
| SMILES | Nc1nc(Cl)ccc1C(=O)[O-].O=C(O)c1ccc(Cl)nc1Cl.[Li+] |
| InChI | InChI=1S/C6H3Cl2NO2.C6H5ClN2O2.Li/c2*7-4-2-1-3(6(10)11)5(8)9-4;/h1-2H,(H,10,11);1-2H,(H2,8,9)(H,10,11);/q;;+1/p-1 |
| InChIKey | IAOKENUUHGFVDT-UHFFFAOYSA-M |
| XLogP | -1.23 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|