C6H5AlN2O2 — CID 142991436
CID 142991436 (PubChem CID 142991436) has the molecular formula C6H5AlN2O2 and a molecular weight of 164.10 g/mol.
| Compound Name | CID 142991436 |
|---|---|
| PubChem CID | 142991436 |
| Molecular Formula | C6H5AlN2O2 |
| Molecular Weight | 164.10 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | — |
| SMILES | Nc1nc([Al])ccc1C(=O)O |
| InChI | InChI=1S/C6H5N2O2.Al/c7-5-4(6(9)10)2-1-3-8-5;/h1-2H,(H2,7,8)(H,9,10); |
| InChIKey | HLNKWXOHYOAEIL-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.10 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |