C13H6Cl2N2O5 — CID 14091944
2-(2,6-dichloropyridine-3-carbonyl)-5-nitrobenzoic acid (PubChem CID 14091944) has the molecular formula C13H6Cl2N2O5 and a molecular weight of 341.11 g/mol. Its IUPAC name is 2-(2,6-dichloropyridine-3-carbonyl)-5-nitrobenzoic acid.
| Compound Name | 2-(2,6-dichloropyridine-3-carbonyl)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 14091944 |
| Molecular Formula | C13H6Cl2N2O5 |
| Molecular Weight | 341.11 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 2-(2,6-dichloropyridine-3-carbonyl)-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1C(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C13H6Cl2N2O5/c14-10-4-3-8(12(15)16-10)11(18)7-2-1-6(17(21)22)5-9(7)13(19)20/h1-5H,(H,19,20) |
| InChIKey | URMQKUTWCUVQKY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.11 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|