C19H19Cl3N2O4 — CID 175912460
ethyl 2-chloro-6-cyclopropylpyridine-3-carboxylate;ethyl 2,6-dichloropyridine-3-carboxylate (PubChem CID 175912460) has the molecular formula C19H19Cl3N2O4 and a molecular weight of 445.73 g/mol. Its IUPAC name is ethyl 2-chloro-6-cyclopropylpyridine-3-carboxylate;ethyl 2,6-dichloropyridine-3-carboxylate.
| Compound Name | ethyl 2-chloro-6-cyclopropylpyridine-3-carboxylate;ethyl 2,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 175912460 |
| Molecular Formula | C19H19Cl3N2O4 |
| Molecular Weight | 445.73 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | ethyl 2-chloro-6-cyclopropylpyridine-3-carboxylate;ethyl 2,6-dichloropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(C2CC2)nc1Cl.CCOC(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C11H12ClNO2.C8H7Cl2NO2/c1-2-15-11(14)8-5-6-9(7-3-4-7)13-10(8)12;1-2-13-8(12)5-3-4-6(9)11-7(5)10/h5-7H,2-4H2,1H3;3-4H,2H2,1H3 |
| InChIKey | ZVKQZAAWUUTONO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.73 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|