C21H25ClN4O3SSi — CID 156680998
N-(benzenesulfonyl)-6-[3-[tert-butyl(dimethyl)silyl]pyrazol-1-yl]-2-chloropyridine-3-carboxamide (PubChem CID 156680998) has the molecular formula C21H25ClN4O3SSi and a molecular weight of 477.06 g/mol. Its IUPAC name is N-(benzenesulfonyl)-6-[3-[tert-butyl(dimethyl)silyl]pyrazol-1-yl]-2-chloropyridine-3-carboxamide.
| Compound Name | N-(benzenesulfonyl)-6-[3-[tert-butyl(dimethyl)silyl]pyrazol-1-yl]-2-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 156680998 |
| Molecular Formula | C21H25ClN4O3SSi |
| Molecular Weight | 477.06 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-(benzenesulfonyl)-6-[3-[tert-butyl(dimethyl)silyl]pyrazol-1-yl]-2-chloropyridine-3-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)c1ccn(-c2ccc(C(=O)NS(=O)(=O)c3ccccc3)c(Cl)n2)n1 |
| InChI | InChI=1S/C21H25ClN4O3SSi/c1-21(2,3)31(4,5)18-13-14-26(24-18)17-12-11-16(19(22)23-17)20(27)25-30(28,29)15-9-7-6-8-10-15/h6-14H,1-5H3,(H,25,27) |
| InChIKey | PWVSJTSAIOYKGV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.06 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|