C13H14ClN3O3 — CID 142372540
2-chloro-6-(3-methoxypyrazol-1-yl)pyridine-3-carboxylic acid;prop-1-ene (PubChem CID 142372540) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is 2-chloro-6-(3-methoxypyrazol-1-yl)pyridine-3-carboxylic acid;prop-1-ene.
| Compound Name | 2-chloro-6-(3-methoxypyrazol-1-yl)pyridine-3-carboxylic acid;prop-1-ene |
|---|---|
| PubChem CID | 142372540 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-chloro-6-(3-methoxypyrazol-1-yl)pyridine-3-carboxylic acid;prop-1-ene |
| SMILES | C=CC.COc1ccn(-c2ccc(C(=O)O)c(Cl)n2)n1 |
| InChI | InChI=1S/C10H8ClN3O3.C3H6/c1-17-8-4-5-14(13-8)7-3-2-6(10(15)16)9(11)12-7;1-3-2/h2-5H,1H3,(H,15,16);3H,1H2,2H3 |
| InChIKey | MAKJPVXSTHRMMU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|