C11H8BBrCl2N2O2S — CID 153351064
N-[bromo-(2,6-dichloro-3-pyridinyl)boranyl]benzenesulfonamide (PubChem CID 153351064) has the molecular formula C11H8BBrCl2N2O2S and a molecular weight of 393.89 g/mol. Its IUPAC name is N-[bromo-(2,6-dichloro-3-pyridinyl)boranyl]benzenesulfonamide.
| Compound Name | N-[bromo-(2,6-dichloro-3-pyridinyl)boranyl]benzenesulfonamide |
|---|---|
| PubChem CID | 153351064 |
| Molecular Formula | C11H8BBrCl2N2O2S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | N-[bromo-(2,6-dichloro-3-pyridinyl)boranyl]benzenesulfonamide |
| SMILES | O=S(=O)(NB(Br)c1ccc(Cl)nc1Cl)c1ccccc1 |
| InChI | InChI=1S/C11H8BBrCl2N2O2S/c13-12(9-6-7-10(14)16-11(9)15)17-20(18,19)8-4-2-1-3-5-8/h1-7,17H |
| InChIKey | FFGCBUVAQSTKJE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|