About N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide
N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide (PubChem CID 164941165) has the molecular formula C11H6F4N2O2S
and a molecular weight of 306.24 g/mol. Its IUPAC name is N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide |
| PubChem CID | 164941165 |
| Molecular Formula | C11H6F4N2O2S |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1c(F)nc(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C11H6F4N2O2S/c12-7-8(13)10(14)16-11(15)9(7)17-20(18,19)6-4-2-1-3-5-6/h1-5,17H |
| InChIKey | NZPOPLCJCYIJDD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide?
The IUPAC name of N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide (CID 164941165) is N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide.
What is the SMILES notation for N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide?
The canonical SMILES for N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide is O=S(=O)(Nc1c(F)nc(F)c(F)c1F)c1ccccc1.
What is the InChIKey of N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide?
The InChIKey is NZPOPLCJCYIJDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F4N2O2S/c12-7-8(13)10(14)16-11(15)9(7)17-20(18,19)6-4-2-1-3-5-6/h1-5,17H.
What are the key properties of N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide?
N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide has a molecular weight of 306.24 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4,5,6-tetrafluoro-3-pyridinyl)benzenesulfonamide is sourced from PubChem (CID 164941165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).