C12H8F4N2O2S — CID 2478133
N'-(2,3,5,6-tetrafluorophenyl)benzenesulfonohydrazide (PubChem CID 2478133) has the molecular formula C12H8F4N2O2S and a molecular weight of 320.27 g/mol. Its IUPAC name is N'-(2,3,5,6-tetrafluorophenyl)benzenesulfonohydrazide.
| Compound Name | N'-(2,3,5,6-tetrafluorophenyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 2478133 |
| Molecular Formula | C12H8F4N2O2S |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N'-(2,3,5,6-tetrafluorophenyl)benzenesulfonohydrazide |
| SMILES | O=S(=O)(NNc1c(F)c(F)cc(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C12H8F4N2O2S/c13-8-6-9(14)11(16)12(10(8)15)17-18-21(19,20)7-4-2-1-3-5-7/h1-6,17-18H |
| InChIKey | KOHZVAGXAYOJMQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|