C21H16F4N2O3S2 — CID 23098353
2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)propanamide (PubChem CID 23098353) has the molecular formula C21H16F4N2O3S2 and a molecular weight of 484.50 g/mol. Its IUPAC name is 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)propanamide.
| Compound Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)propanamide |
|---|---|
| PubChem CID | 23098353 |
| Molecular Formula | C21H16F4N2O3S2 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)propanamide |
| SMILES | CC(Sc1ccc(NS(=O)(=O)c2ccccc2)cc1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C21H16F4N2O3S2/c1-12(21(28)26-20-18(24)16(22)11-17(23)19(20)25)31-14-9-7-13(8-10-14)27-32(29,30)15-5-3-2-4-6-15/h2-12,27H,1H3,(H,26,28) |
| InChIKey | AXACPLZUXRVZPL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|