C23H18F4N2O3S — CID 23097634
3-methoxy-N-[4-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl]sulfanylphenyl]benzamide (PubChem CID 23097634) has the molecular formula C23H18F4N2O3S and a molecular weight of 478.47 g/mol. Its IUPAC name is 3-methoxy-N-[4-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 3-methoxy-N-[4-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 23097634 |
| Molecular Formula | C23H18F4N2O3S |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 3-methoxy-N-[4-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl]sulfanylphenyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(SC(C)C(=O)Nc3c(F)c(F)cc(F)c3F)cc2)c1 |
| InChI | InChI=1S/C23H18F4N2O3S/c1-12(22(30)29-21-19(26)17(24)11-18(25)20(21)27)33-16-8-6-14(7-9-16)28-23(31)13-4-3-5-15(10-13)32-2/h3-12H,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | APOOUWWPHZLMIP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|