C24H21F3N2O3S — CID 18903236
3-methoxy-N-[3-[1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl]sulfanylphenyl]benzamide (PubChem CID 18903236) has the molecular formula C24H21F3N2O3S and a molecular weight of 474.50 g/mol. Its IUPAC name is 3-methoxy-N-[3-[1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 3-methoxy-N-[3-[1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18903236 |
| Molecular Formula | C24H21F3N2O3S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 3-methoxy-N-[3-[1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl]sulfanylphenyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc(SC(C)C(=O)Nc3cccc(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C24H21F3N2O3S/c1-15(22(30)28-18-8-4-7-17(13-18)24(25,26)27)33-21-11-5-9-19(14-21)29-23(31)16-6-3-10-20(12-16)32-2/h3-15H,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | CIYLQRUOBQOWBF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |