C16H15F4NO2S — CID 22774577
4-(2-methylpropyl)-N-(2,3,5,6-tetrafluorophenyl)benzenesulfonamide (PubChem CID 22774577) has the molecular formula C16H15F4NO2S and a molecular weight of 361.36 g/mol. Its IUPAC name is 4-(2-methylpropyl)-N-(2,3,5,6-tetrafluorophenyl)benzenesulfonamide.
| Compound Name | 4-(2-methylpropyl)-N-(2,3,5,6-tetrafluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22774577 |
| Molecular Formula | C16H15F4NO2S |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 4-(2-methylpropyl)-N-(2,3,5,6-tetrafluorophenyl)benzenesulfonamide |
| SMILES | CC(C)Cc1ccc(S(=O)(=O)Nc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C16H15F4NO2S/c1-9(2)7-10-3-5-11(6-4-10)24(22,23)21-16-14(19)12(17)8-13(18)15(16)20/h3-6,8-9,21H,7H2,1-2H3 |
| InChIKey | MEOOKOOJTWNZKR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|