C17H21NO2S2 — CID 17388107
4-(2-methylpropyl)-N-(2-methylsulfanylphenyl)benzenesulfonamide (PubChem CID 17388107) has the molecular formula C17H21NO2S2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 4-(2-methylpropyl)-N-(2-methylsulfanylphenyl)benzenesulfonamide.
| Compound Name | 4-(2-methylpropyl)-N-(2-methylsulfanylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 17388107 |
| Molecular Formula | C17H21NO2S2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-(2-methylpropyl)-N-(2-methylsulfanylphenyl)benzenesulfonamide |
| SMILES | CSc1ccccc1NS(=O)(=O)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C17H21NO2S2/c1-13(2)12-14-8-10-15(11-9-14)22(19,20)18-16-6-4-5-7-17(16)21-3/h4-11,13,18H,12H2,1-3H3 |
| InChIKey | VVEQTKIJVVXBBX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |