C15H17NO2S3 — CID 28570483
N-(2-ethylsulfanylphenyl)-4-methylsulfanylbenzenesulfonamide (PubChem CID 28570483) has the molecular formula C15H17NO2S3 and a molecular weight of 339.51 g/mol. Its IUPAC name is N-(2-ethylsulfanylphenyl)-4-methylsulfanylbenzenesulfonamide.
| Compound Name | N-(2-ethylsulfanylphenyl)-4-methylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 28570483 |
| Molecular Formula | C15H17NO2S3 |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-(2-ethylsulfanylphenyl)-4-methylsulfanylbenzenesulfonamide |
| SMILES | CCSc1ccccc1NS(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C15H17NO2S3/c1-3-20-15-7-5-4-6-14(15)16-21(17,18)13-10-8-12(19-2)9-11-13/h4-11,16H,3H2,1-2H3 |
| InChIKey | STRCTYJCFLTFAG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |