C19H18N2O4S3 — CID 25331209
1-N-methyl-4-N-(2-phenylsulfanylphenyl)benzene-1,4-disulfonamide (PubChem CID 25331209) has the molecular formula C19H18N2O4S3 and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-N-methyl-4-N-(2-phenylsulfanylphenyl)benzene-1,4-disulfonamide.
| Compound Name | 1-N-methyl-4-N-(2-phenylsulfanylphenyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 25331209 |
| Molecular Formula | C19H18N2O4S3 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 1-N-methyl-4-N-(2-phenylsulfanylphenyl)benzene-1,4-disulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(S(=O)(=O)Nc2ccccc2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N2O4S3/c1-20-27(22,23)16-11-13-17(14-12-16)28(24,25)21-18-9-5-6-10-19(18)26-15-7-3-2-4-8-15/h2-14,20-21H,1H3 |
| InChIKey | SKAAUAAJMZHQMZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |