C22H23NO2S2 — CID 22202239
4-butyl-N-(2-phenylsulfanylphenyl)benzenesulfonamide (PubChem CID 22202239) has the molecular formula C22H23NO2S2 and a molecular weight of 397.57 g/mol. Its IUPAC name is 4-butyl-N-(2-phenylsulfanylphenyl)benzenesulfonamide.
| Compound Name | 4-butyl-N-(2-phenylsulfanylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22202239 |
| Molecular Formula | C22H23NO2S2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-butyl-N-(2-phenylsulfanylphenyl)benzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2ccccc2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO2S2/c1-2-3-9-18-14-16-20(17-15-18)27(24,25)23-21-12-7-8-13-22(21)26-19-10-5-4-6-11-19/h4-8,10-17,23H,2-3,9H2,1H3 |
| InChIKey | MYKQJRPDVFHKLT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |