C19H17ClN2O4S3 — CID 2967801
N-(2-chlorophenyl)-4-[(4-methylsulfanylphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 2967801) has the molecular formula C19H17ClN2O4S3 and a molecular weight of 469.01 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[(4-methylsulfanylphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | N-(2-chlorophenyl)-4-[(4-methylsulfanylphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 2967801 |
| Molecular Formula | C19H17ClN2O4S3 |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | N-(2-chlorophenyl)-4-[(4-methylsulfanylphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | CSc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C19H17ClN2O4S3/c1-27-15-8-12-17(13-9-15)28(23,24)21-14-6-10-16(11-7-14)29(25,26)22-19-5-3-2-4-18(19)20/h2-13,21-22H,1H3 |
| InChIKey | LACOSAHAQPMAMT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |