C20H19ClN2O4S3 — CID 126416212
N-(3-chloro-4-methylphenyl)-4-[(4-methylsulfanylphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 126416212) has the molecular formula C20H19ClN2O4S3 and a molecular weight of 483.04 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-4-[(4-methylsulfanylphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-4-[(4-methylsulfanylphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 126416212 |
| Molecular Formula | C20H19ClN2O4S3 |
| Molecular Weight | 483.04 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-4-[(4-methylsulfanylphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | CSc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccc(C)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C20H19ClN2O4S3/c1-14-3-4-16(13-20(14)21)23-30(26,27)18-9-5-15(6-10-18)22-29(24,25)19-11-7-17(28-2)8-12-19/h3-13,22-23H,1-2H3 |
| InChIKey | MNTOOQQNJXKXHO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.04 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |