C11H6F4N2O3S — CID 107642714
6-oxo-N-(2,3,5,6-tetrafluorophenyl)-1H-pyridine-3-sulfonamide (PubChem CID 107642714) has the molecular formula C11H6F4N2O3S and a molecular weight of 322.24 g/mol. Its IUPAC name is 6-oxo-N-(2,3,5,6-tetrafluorophenyl)-1H-pyridine-3-sulfonamide.
| Compound Name | 6-oxo-N-(2,3,5,6-tetrafluorophenyl)-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107642714 |
| Molecular Formula | C11H6F4N2O3S |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 6-oxo-N-(2,3,5,6-tetrafluorophenyl)-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)Nc2c(F)c(F)cc(F)c2F)c[nH]1 |
| InChI | InChI=1S/C11H6F4N2O3S/c12-6-3-7(13)10(15)11(9(6)14)17-21(19,20)5-1-2-8(18)16-4-5/h1-4,17H,(H,16,18) |
| InChIKey | UZSFNNRZKMXXLH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|