C11H7BrF2N2O3S — CID 43629170
N-(2-bromo-4,6-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 43629170) has the molecular formula C11H7BrF2N2O3S and a molecular weight of 365.16 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 43629170 |
| Molecular Formula | C11H7BrF2N2O3S |
| Molecular Weight | 365.16 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)Nc2c(F)cc(F)cc2Br)c[nH]1 |
| InChI | InChI=1S/C11H7BrF2N2O3S/c12-8-3-6(13)4-9(14)11(8)16-20(18,19)7-1-2-10(17)15-5-7/h1-5,16H,(H,15,17) |
| InChIKey | MDUQQSVZQBDELK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |