C13H12F2N2O3S — CID 61249942
N-[1-(2,4-difluorophenyl)ethyl]-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 61249942) has the molecular formula C13H12F2N2O3S and a molecular weight of 314.31 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61249942 |
| Molecular Formula | C13H12F2N2O3S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(=O)[nH]c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H12F2N2O3S/c1-8(11-4-2-9(14)6-12(11)15)17-21(19,20)10-3-5-13(18)16-7-10/h2-8,17H,1H3,(H,16,18) |
| InChIKey | PNYBAZLZOIJMES-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |