C14H11Br2F2NO2S — CID 55907244
2,4-dibromo-N-[1-(2,4-difluorophenyl)ethyl]benzenesulfonamide (PubChem CID 55907244) has the molecular formula C14H11Br2F2NO2S and a molecular weight of 455.12 g/mol. Its IUPAC name is 2,4-dibromo-N-[1-(2,4-difluorophenyl)ethyl]benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-[1-(2,4-difluorophenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55907244 |
| Molecular Formula | C14H11Br2F2NO2S |
| Molecular Weight | 455.12 g/mol |
| Exact Mass | 452.88 |
| IUPAC Name | 2,4-dibromo-N-[1-(2,4-difluorophenyl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(Br)cc1Br)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H11Br2F2NO2S/c1-8(11-4-3-10(17)7-13(11)18)19-22(20,21)14-5-2-9(15)6-12(14)16/h2-8,19H,1H3 |
| InChIKey | MBOCIXUZUDDESC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.12 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |