C15H14BrF2NO3S — CID 55352646
5-bromo-N-[1-(2,4-difluorophenyl)ethyl]-2-methoxybenzenesulfonamide (PubChem CID 55352646) has the molecular formula C15H14BrF2NO3S and a molecular weight of 406.25 g/mol. Its IUPAC name is 5-bromo-N-[1-(2,4-difluorophenyl)ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-[1-(2,4-difluorophenyl)ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 55352646 |
| Molecular Formula | C15H14BrF2NO3S |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 5-bromo-N-[1-(2,4-difluorophenyl)ethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NC(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H14BrF2NO3S/c1-9(12-5-4-11(17)8-13(12)18)19-23(20,21)15-7-10(16)3-6-14(15)22-2/h3-9,19H,1-2H3 |
| InChIKey | CMMZGTAABMEIFP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |