C17H19BrFNO3S — CID 24511478
5-bromo-N-[1-(4-fluorophenyl)-2-methylpropyl]-2-methoxybenzenesulfonamide (PubChem CID 24511478) has the molecular formula C17H19BrFNO3S and a molecular weight of 416.31 g/mol. Its IUPAC name is 5-bromo-N-[1-(4-fluorophenyl)-2-methylpropyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-[1-(4-fluorophenyl)-2-methylpropyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 24511478 |
| Molecular Formula | C17H19BrFNO3S |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 5-bromo-N-[1-(4-fluorophenyl)-2-methylpropyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NC(c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C17H19BrFNO3S/c1-11(2)17(12-4-7-14(19)8-5-12)20-24(21,22)16-10-13(18)6-9-15(16)23-3/h4-11,17,20H,1-3H3 |
| InChIKey | MYPJTMCFJCRZAZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |