C19H24BrNO3S — CID 133199241
5-bromo-N-[1-(4-tert-butylphenyl)ethyl]-2-methoxybenzenesulfonamide (PubChem CID 133199241) has the molecular formula C19H24BrNO3S and a molecular weight of 426.38 g/mol. Its IUPAC name is 5-bromo-N-[1-(4-tert-butylphenyl)ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-[1-(4-tert-butylphenyl)ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 133199241 |
| Molecular Formula | C19H24BrNO3S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 5-bromo-N-[1-(4-tert-butylphenyl)ethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NC(C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H24BrNO3S/c1-13(14-6-8-15(9-7-14)19(2,3)4)21-25(22,23)18-12-16(20)10-11-17(18)24-5/h6-13,21H,1-5H3 |
| InChIKey | GULQQDVUKBNMED-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |