C11H8F2N2O3S — CID 61075597
N-(2,3-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 61075597) has the molecular formula C11H8F2N2O3S and a molecular weight of 286.26 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-(2,3-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61075597 |
| Molecular Formula | C11H8F2N2O3S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | N-(2,3-difluorophenyl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)Nc2cccc(F)c2F)c[nH]1 |
| InChI | InChI=1S/C11H8F2N2O3S/c12-8-2-1-3-9(11(8)13)15-19(17,18)7-4-5-10(16)14-6-7/h1-6,15H,(H,14,16) |
| InChIKey | PJKOOIBKVDASDF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |