C12H10F2N2O3S — CID 61076963
3-amino-N-(2,3-difluorophenyl)-4-hydroxybenzenesulfonamide (PubChem CID 61076963) has the molecular formula C12H10F2N2O3S and a molecular weight of 300.29 g/mol. Its IUPAC name is 3-amino-N-(2,3-difluorophenyl)-4-hydroxybenzenesulfonamide.
| Compound Name | 3-amino-N-(2,3-difluorophenyl)-4-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 61076963 |
| Molecular Formula | C12H10F2N2O3S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-amino-N-(2,3-difluorophenyl)-4-hydroxybenzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)Nc2cccc(F)c2F)ccc1O |
| InChI | InChI=1S/C12H10F2N2O3S/c13-8-2-1-3-10(12(8)14)16-20(18,19)7-4-5-11(17)9(15)6-7/h1-6,16-17H,15H2 |
| InChIKey | MQJGSXUOTXEGIP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|