C6H8N2O4S — CID 107858243
N-methoxy-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 107858243) has the molecular formula C6H8N2O4S and a molecular weight of 204.21 g/mol. Its IUPAC name is N-methoxy-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-methoxy-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107858243 |
| Molecular Formula | C6H8N2O4S |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | N-methoxy-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CONS(=O)(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C6H8N2O4S/c1-12-8-13(10,11)5-2-3-6(9)7-4-5/h2-4,8H,1H3,(H,7,9) |
| InChIKey | JUZUXOWRKPSONK-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|