C13H14N2O4S — CID 61249722
N-[2-(methoxymethyl)phenyl]-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 61249722) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is N-[2-(methoxymethyl)phenyl]-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-[2-(methoxymethyl)phenyl]-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61249722 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-[2-(methoxymethyl)phenyl]-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | COCc1ccccc1NS(=O)(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C13H14N2O4S/c1-19-9-10-4-2-3-5-12(10)15-20(17,18)11-6-7-13(16)14-8-11/h2-8,15H,9H2,1H3,(H,14,16) |
| InChIKey | NVRQMJILPSDRIY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |