C13H16N4O3S — CID 62151716
N-[2-(methoxymethyl)phenyl]-2-(methylamino)pyrimidine-5-sulfonamide (PubChem CID 62151716) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-[2-(methoxymethyl)phenyl]-2-(methylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-[2-(methoxymethyl)phenyl]-2-(methylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62151716 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-[2-(methoxymethyl)phenyl]-2-(methylamino)pyrimidine-5-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)Nc2ccccc2COC)cn1 |
| InChI | InChI=1S/C13H16N4O3S/c1-14-13-15-7-11(8-16-13)21(18,19)17-12-6-4-3-5-10(12)9-20-2/h3-8,17H,9H2,1-2H3,(H,14,15,16) |
| InChIKey | CRNRZPGVDDXTBU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |