C19H12F5NO2S — CID 23217439
N-[2,3,4,5-tetrafluoro-6-(4-fluoro-3-methylphenyl)phenyl]benzenesulfonamide (PubChem CID 23217439) has the molecular formula C19H12F5NO2S and a molecular weight of 413.37 g/mol. Its IUPAC name is N-[2,3,4,5-tetrafluoro-6-(4-fluoro-3-methylphenyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2,3,4,5-tetrafluoro-6-(4-fluoro-3-methylphenyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23217439 |
| Molecular Formula | C19H12F5NO2S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | N-[2,3,4,5-tetrafluoro-6-(4-fluoro-3-methylphenyl)phenyl]benzenesulfonamide |
| SMILES | Cc1cc(-c2c(F)c(F)c(F)c(F)c2NS(=O)(=O)c2ccccc2)ccc1F |
| InChI | InChI=1S/C19H12F5NO2S/c1-10-9-11(7-8-13(10)20)14-15(21)16(22)17(23)18(24)19(14)25-28(26,27)12-5-3-2-4-6-12/h2-9,25H,1H3 |
| InChIKey | KMUXBKFFFLALSB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|