C15H16FNO2S — CID 56737871
N-(2,6-dimethylphenyl)-4-fluoro-3-methylbenzenesulfonamide (PubChem CID 56737871) has the molecular formula C15H16FNO2S and a molecular weight of 293.36 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-fluoro-3-methylbenzenesulfonamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-fluoro-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 56737871 |
| Molecular Formula | C15H16FNO2S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-fluoro-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2c(C)cccc2C)ccc1F |
| InChI | InChI=1S/C15H16FNO2S/c1-10-5-4-6-11(2)15(10)17-20(18,19)13-7-8-14(16)12(3)9-13/h4-9,17H,1-3H3 |
| InChIKey | ZQSWVBATBMTQBL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |