C14H12BrF2NO2S — CID 61062760
N-(4-bromo-2,6-dimethylphenyl)-3,4-difluorobenzenesulfonamide (PubChem CID 61062760) has the molecular formula C14H12BrF2NO2S and a molecular weight of 376.22 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-3,4-difluorobenzenesulfonamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 61062760 |
| Molecular Formula | C14H12BrF2NO2S |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-3,4-difluorobenzenesulfonamide |
| SMILES | Cc1cc(Br)cc(C)c1NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H12BrF2NO2S/c1-8-5-10(15)6-9(2)14(8)18-21(19,20)11-3-4-12(16)13(17)7-11/h3-7,18H,1-2H3 |
| InChIKey | SHNGBWKHSNVJKX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |