C9H7FN2O2S2 — CID 87198601
N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 87198601) has the molecular formula C9H7FN2O2S2 and a molecular weight of 258.30 g/mol. Its IUPAC name is N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 87198601 |
| Molecular Formula | C9H7FN2O2S2 |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncc(F)s1)c1ccccc1 |
| InChI | InChI=1S/C9H7FN2O2S2/c10-8-6-11-9(15-8)12-16(13,14)7-4-2-1-3-5-7/h1-6H,(H,11,12) |
| InChIKey | LDFZCRJAUKADLQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |