C11H10N2O4S2 — CID 20983476
2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 20983476) has the molecular formula C11H10N2O4S2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 20983476 |
| Molecular Formula | C11H10N2O4S2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(NS(=O)(=O)c2ccccc2)sc1C(=O)O |
| InChI | InChI=1S/C11H10N2O4S2/c1-7-9(10(14)15)18-11(12-7)13-19(16,17)8-5-3-2-4-6-8/h2-6H,1H3,(H,12,13)(H,14,15) |
| InChIKey | BJBILUVLLDIVBX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |