2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid

C11H10N2O4S2 — CID 20983476

IUPAC2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(NS(=O)(=O)c2ccccc2)sc1C(=O)O
InChIInChI=1S/C11H10N2O4S2/c1-7-9(10(14)15)18-11(12-7)13-19(16,17)8-5-3-2-4-6-8/h2-6H,1H3,(H,12,13)(H,14,15)
InChIKeyBJBILUVLLDIVBX-UHFFFAOYSA-N
MW298.35 g/mol
LogP1.95
Rot. Bonds4

About 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid

2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 20983476) has the molecular formula C11H10N2O4S2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid
PubChem CID20983476
Molecular FormulaC11H10N2O4S2
Molecular Weight298.35 g/mol
Exact Mass298.01
IUPAC Name2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(NS(=O)(=O)c2ccccc2)sc1C(=O)O
InChIInChI=1S/C11H10N2O4S2/c1-7-9(10(14)15)18-11(12-7)13-19(16,17)8-5-3-2-4-6-8/h2-6H,1H3,(H,12,13)(H,14,15)
InChIKeyBJBILUVLLDIVBX-UHFFFAOYSA-N
XLogP1.95
TPSA96.36 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.35
LogP ≤ 51.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid (CID 20983476) is 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid is Cc1nc(NS(=O)(=O)c2ccccc2)sc1C(=O)O.
What is the InChIKey of 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is BJBILUVLLDIVBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O4S2/c1-7-9(10(14)15)18-11(12-7)13-19(16,17)8-5-3-2-4-6-8/h2-6H,1H3,(H,12,13)(H,14,15).
What are the key properties of 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid?
2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 298.35 g/mol, XLogP of 1.95, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 20983476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).