C13H14N4O4S2 — CID 24939194
N-[5-(benzenesulfonamidocarbamoyl)-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 24939194) has the molecular formula C13H14N4O4S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[5-(benzenesulfonamidocarbamoyl)-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-(benzenesulfonamidocarbamoyl)-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 24939194 |
| Molecular Formula | C13H14N4O4S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | N-[5-(benzenesulfonamidocarbamoyl)-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(C(=O)NNS(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C13H14N4O4S2/c1-8-11(22-13(14-8)15-9(2)18)12(19)16-17-23(20,21)10-6-4-3-5-7-10/h3-7,17H,1-2H3,(H,16,19)(H,14,15,18) |
| InChIKey | AXVUMHBXKKCSDN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|