C17H15ClN4O3S2 — CID 87177095
N-[5-[2-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 87177095) has the molecular formula C17H15ClN4O3S2 and a molecular weight of 422.92 g/mol. Its IUPAC name is N-[5-[2-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[2-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 87177095 |
| Molecular Formula | C17H15ClN4O3S2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | N-[5-[2-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(-c2ccc(Cl)nc2NS(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C17H15ClN4O3S2/c1-10-15(26-17(19-10)20-11(2)23)13-8-9-14(18)21-16(13)22-27(24,25)12-6-4-3-5-7-12/h3-9H,1-2H3,(H,21,22)(H,19,20,23) |
| InChIKey | SZMSMNNJQPQMHH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|