C11H11N3O3S2 — CID 71326100
N-[5-(benzenesulfonamido)-1,3-thiazol-2-yl]acetamide (PubChem CID 71326100) has the molecular formula C11H11N3O3S2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[5-(benzenesulfonamido)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-(benzenesulfonamido)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 71326100 |
| Molecular Formula | C11H11N3O3S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | N-[5-(benzenesulfonamido)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(NS(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C11H11N3O3S2/c1-8(15)13-11-12-7-10(18-11)14-19(16,17)9-5-3-2-4-6-9/h2-7,14H,1H3,(H,12,13,15) |
| InChIKey | WPGSFESAXSSUIM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |