C5H7ClN2O4S2 — CID 174821930
2-acetamido-1,3-thiazole-5-sulfonic acid;hydrochloride (PubChem CID 174821930) has the molecular formula C5H7ClN2O4S2 and a molecular weight of 258.71 g/mol. Its IUPAC name is 2-acetamido-1,3-thiazole-5-sulfonic acid;hydrochloride.
| Compound Name | 2-acetamido-1,3-thiazole-5-sulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174821930 |
| Molecular Formula | C5H7ClN2O4S2 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 257.95 |
| IUPAC Name | 2-acetamido-1,3-thiazole-5-sulfonic acid;hydrochloride |
| SMILES | CC(=O)Nc1ncc(S(=O)(=O)O)s1.Cl |
| InChI | InChI=1S/C5H6N2O4S2.ClH/c1-3(8)7-5-6-2-4(12-5)13(9,10)11;/h2H,1H3,(H,6,7,8)(H,9,10,11);1H |
| InChIKey | JQYMUTLRDNFKER-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|