C17H27N3O4S2 — CID 87416992
2-[[cyclohexyl-(4-methylcyclohexyl)carbamoyl]amino]-1,3-thiazole-5-sulfonic acid (PubChem CID 87416992) has the molecular formula C17H27N3O4S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-[[cyclohexyl-(4-methylcyclohexyl)carbamoyl]amino]-1,3-thiazole-5-sulfonic acid.
| Compound Name | 2-[[cyclohexyl-(4-methylcyclohexyl)carbamoyl]amino]-1,3-thiazole-5-sulfonic acid |
|---|---|
| PubChem CID | 87416992 |
| Molecular Formula | C17H27N3O4S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-[[cyclohexyl-(4-methylcyclohexyl)carbamoyl]amino]-1,3-thiazole-5-sulfonic acid |
| SMILES | CC1CCC(N(C(=O)Nc2ncc(S(=O)(=O)O)s2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C17H27N3O4S2/c1-12-7-9-14(10-8-12)20(13-5-3-2-4-6-13)17(21)19-16-18-11-15(25-16)26(22,23)24/h11-14H,2-10H2,1H3,(H,18,19,21)(H,22,23,24) |
| InChIKey | VBDFOTUBHPUXHS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|