C24H39N3O3S — CID 58183155
tert-butyl 4-[2-(dicyclohexylcarbamoylamino)-1,3-thiazol-5-yl]butanoate (PubChem CID 58183155) has the molecular formula C24H39N3O3S and a molecular weight of 449.66 g/mol. Its IUPAC name is tert-butyl 4-[2-(dicyclohexylcarbamoylamino)-1,3-thiazol-5-yl]butanoate.
| Compound Name | tert-butyl 4-[2-(dicyclohexylcarbamoylamino)-1,3-thiazol-5-yl]butanoate |
|---|---|
| PubChem CID | 58183155 |
| Molecular Formula | C24H39N3O3S |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | tert-butyl 4-[2-(dicyclohexylcarbamoylamino)-1,3-thiazol-5-yl]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCc1cnc(NC(=O)N(C2CCCCC2)C2CCCCC2)s1 |
| InChI | InChI=1S/C24H39N3O3S/c1-24(2,3)30-21(28)16-10-15-20-17-25-22(31-20)26-23(29)27(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h17-19H,4-16H2,1-3H3,(H,25,26,29) |
| InChIKey | TVEOUEKKYIOZPV-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |