C24H34N4OS — CID 141119437
3-[5-[(benzylamino)methyl]-1,3-thiazol-2-yl]-1,1-dicyclohexylurea (PubChem CID 141119437) has the molecular formula C24H34N4OS and a molecular weight of 426.63 g/mol. Its IUPAC name is 3-[5-[(benzylamino)methyl]-1,3-thiazol-2-yl]-1,1-dicyclohexylurea.
| Compound Name | 3-[5-[(benzylamino)methyl]-1,3-thiazol-2-yl]-1,1-dicyclohexylurea |
|---|---|
| PubChem CID | 141119437 |
| Molecular Formula | C24H34N4OS |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 3-[5-[(benzylamino)methyl]-1,3-thiazol-2-yl]-1,1-dicyclohexylurea |
| SMILES | O=C(Nc1ncc(CNCc2ccccc2)s1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H34N4OS/c29-24(28(20-12-6-2-7-13-20)21-14-8-3-9-15-21)27-23-26-18-22(30-23)17-25-16-19-10-4-1-5-11-19/h1,4-5,10-11,18,20-21,25H,2-3,6-9,12-17H2,(H,26,27,29) |
| InChIKey | ZQAQPCIOJNVISR-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |