C14H20ClN3O2S — CID 87186057
3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(oxolan-2-yl)urea (PubChem CID 87186057) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(oxolan-2-yl)urea.
| Compound Name | 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(oxolan-2-yl)urea |
|---|---|
| PubChem CID | 87186057 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(oxolan-2-yl)urea |
| SMILES | O=C(Nc1ncc(Cl)s1)N(C1CCCCC1)C1CCCO1 |
| InChI | InChI=1S/C14H20ClN3O2S/c15-11-9-16-13(21-11)17-14(19)18(12-7-4-8-20-12)10-5-2-1-3-6-10/h9-10,12H,1-8H2,(H,16,17,19) |
| InChIKey | ITFSKVCOHHVDTK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |