C16H25N3OS2 — CID 141119422
1-cyclopentyl-1-(4-methylcyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea (PubChem CID 141119422) has the molecular formula C16H25N3OS2 and a molecular weight of 339.53 g/mol. Its IUPAC name is 1-cyclopentyl-1-(4-methylcyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-cyclopentyl-1-(4-methylcyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 141119422 |
| Molecular Formula | C16H25N3OS2 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-cyclopentyl-1-(4-methylcyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea |
| SMILES | CC1CCC(N(C(=O)Nc2ncc(S)s2)C2CCCC2)CC1 |
| InChI | InChI=1S/C16H25N3OS2/c1-11-6-8-13(9-7-11)19(12-4-2-3-5-12)16(20)18-15-17-10-14(21)22-15/h10-13,21H,2-9H2,1H3,(H,17,18,20) |
| InChIKey | NPUMSQOTRODQOO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|