C22H29N3O3S2 — CID 143719893
2-[[2-[[cyclohexyl(4-phenylbutyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid (PubChem CID 143719893) has the molecular formula C22H29N3O3S2 and a molecular weight of 447.63 g/mol. Its IUPAC name is 2-[[2-[[cyclohexyl(4-phenylbutyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[2-[[cyclohexyl(4-phenylbutyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 143719893 |
| Molecular Formula | C22H29N3O3S2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-[[2-[[cyclohexyl(4-phenylbutyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1cnc(NC(=O)N(CCCCc2ccccc2)C2CCCCC2)s1 |
| InChI | InChI=1S/C22H29N3O3S2/c26-19(27)16-29-20-15-23-21(30-20)24-22(28)25(18-12-5-2-6-13-18)14-8-7-11-17-9-3-1-4-10-17/h1,3-4,9-10,15,18H,2,5-8,11-14,16H2,(H,26,27)(H,23,24,28) |
| InChIKey | IUMVSIUMACPMOO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|