C22H29N3O5S2 — CID 87420219
2-[[2-[[cyclohexyl-[3-(4-methoxyphenoxy)propyl]carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid (PubChem CID 87420219) has the molecular formula C22H29N3O5S2 and a molecular weight of 479.62 g/mol. Its IUPAC name is 2-[[2-[[cyclohexyl-[3-(4-methoxyphenoxy)propyl]carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[2-[[cyclohexyl-[3-(4-methoxyphenoxy)propyl]carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 87420219 |
| Molecular Formula | C22H29N3O5S2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 2-[[2-[[cyclohexyl-[3-(4-methoxyphenoxy)propyl]carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]acetic acid |
| SMILES | COc1ccc(OCCCN(C(=O)Nc2ncc(SCC(=O)O)s2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H29N3O5S2/c1-29-17-8-10-18(11-9-17)30-13-5-12-25(16-6-3-2-4-7-16)22(28)24-21-23-14-20(32-21)31-15-19(26)27/h8-11,14,16H,2-7,12-13,15H2,1H3,(H,26,27)(H,23,24,28) |
| InChIKey | AYUDPNWIAPUTOQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|