C24H33N3O4S2 — CID 88965496
3-[[2-[[cyclohexyl(2-phenylmethoxyethyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]-2,2-dimethylpropanoic acid (PubChem CID 88965496) has the molecular formula C24H33N3O4S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is 3-[[2-[[cyclohexyl(2-phenylmethoxyethyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[2-[[cyclohexyl(2-phenylmethoxyethyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 88965496 |
| Molecular Formula | C24H33N3O4S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 3-[[2-[[cyclohexyl(2-phenylmethoxyethyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CSc1cnc(NC(=O)N(CCOCc2ccccc2)C2CCCCC2)s1)C(=O)O |
| InChI | InChI=1S/C24H33N3O4S2/c1-24(2,21(28)29)17-32-20-15-25-22(33-20)26-23(30)27(19-11-7-4-8-12-19)13-14-31-16-18-9-5-3-6-10-18/h3,5-6,9-10,15,19H,4,7-8,11-14,16-17H2,1-2H3,(H,28,29)(H,25,26,30) |
| InChIKey | VSKXAFHREIWJBU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|