C23H37N4O6S2- — CID 91807995
5-[2-carboxypropan-2-yl(sulfinato)amino]-2-[[cyclohexyl-(4-propoxycyclohexyl)carbamoyl]amino]-1,3-thiazole (PubChem CID 91807995) has the molecular formula C23H37N4O6S2- and a molecular weight of 529.71 g/mol. Its IUPAC name is 5-[2-carboxypropan-2-yl(sulfinato)amino]-2-[[cyclohexyl-(4-propoxycyclohexyl)carbamoyl]amino]-1,3-thiazole.
| Compound Name | 5-[2-carboxypropan-2-yl(sulfinato)amino]-2-[[cyclohexyl-(4-propoxycyclohexyl)carbamoyl]amino]-1,3-thiazole |
|---|---|
| PubChem CID | 91807995 |
| Molecular Formula | C23H37N4O6S2- |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 5-[2-carboxypropan-2-yl(sulfinato)amino]-2-[[cyclohexyl-(4-propoxycyclohexyl)carbamoyl]amino]-1,3-thiazole |
| SMILES | CCCOC1CCC(N(C(=O)Nc2ncc(N(S(=O)[O-])C(C)(C)C(=O)O)s2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C23H38N4O6S2/c1-4-14-33-18-12-10-17(11-13-18)26(16-8-6-5-7-9-16)22(30)25-21-24-15-19(34-21)27(35(31)32)23(2,3)20(28)29/h15-18H,4-14H2,1-3H3,(H,28,29)(H,31,32)(H,24,25,30)/p-1 |
| InChIKey | NMIWJGZACPUKAP-UHFFFAOYSA-M |
| XLogP | 4.51 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|