C25H40N5O5S2- — CID 90887782
2-(dicyclohexylcarbamoylamino)-5-[(1-ethoxycarbonylpiperidin-4-yl)-sulfinatoamino]-4-methyl-1,3-thiazole (PubChem CID 90887782) has the molecular formula C25H40N5O5S2- and a molecular weight of 554.76 g/mol. Its IUPAC name is 2-(dicyclohexylcarbamoylamino)-5-[(1-ethoxycarbonylpiperidin-4-yl)-sulfinatoamino]-4-methyl-1,3-thiazole.
| Compound Name | 2-(dicyclohexylcarbamoylamino)-5-[(1-ethoxycarbonylpiperidin-4-yl)-sulfinatoamino]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 90887782 |
| Molecular Formula | C25H40N5O5S2- |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 2-(dicyclohexylcarbamoylamino)-5-[(1-ethoxycarbonylpiperidin-4-yl)-sulfinatoamino]-4-methyl-1,3-thiazole |
| SMILES | CCOC(=O)N1CCC(N(c2sc(NC(=O)N(C3CCCCC3)C3CCCCC3)nc2C)S(=O)[O-])CC1 |
| InChI | InChI=1S/C25H41N5O5S2/c1-3-35-25(32)28-16-14-21(15-17-28)30(37(33)34)22-18(2)26-23(36-22)27-24(31)29(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h19-21H,3-17H2,1-2H3,(H,33,34)(H,26,27,31)/p-1 |
| InChIKey | BZIGRISZWNDBBT-UHFFFAOYSA-M |
| XLogP | 5.17 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|